C45H30O16 — CID 161247477
5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;7-hydroxy-3-(4-hydroxyphenyl)chromen-4-one (PubChem CID 161247477) has the molecular formula C45H30O16 and a molecular weight of 826.72 g/mol. Its IUPAC name is 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;7-hydroxy-3-(4-hydroxyphenyl)chromen-4-one.
| Compound Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;7-hydroxy-3-(4-hydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 161247477 |
| Molecular Formula | C45H30O16 |
| Molecular Weight | 826.72 g/mol |
| Exact Mass | 826.15 |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;7-hydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(O)cc(O)c12.O=c1c(-c2ccc(O)cc2)coc2cc(O)ccc12.O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O7.C15H10O5.C15H10O4/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6;16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19;16-10-3-1-9(2-4-10)13-8-19-14-7-11(17)5-6-12(14)15(13)18/h1-5,16-19,21H;1-7,16-18H;1-8,16-17H |
| InChIKey | VAVDRFMBOKVWCS-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 292.93 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.72 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|