C15H9ClO4 — CID 5398360
3-(4-chlorophenyl)-5,7-dihydroxychromen-4-one (PubChem CID 5398360) has the molecular formula C15H9ClO4 and a molecular weight of 288.69 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5,7-dihydroxychromen-4-one.
| Compound Name | 3-(4-chlorophenyl)-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 5398360 |
| Molecular Formula | C15H9ClO4 |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 3-(4-chlorophenyl)-5,7-dihydroxychromen-4-one |
| SMILES | O=c1c(-c2ccc(Cl)cc2)coc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H9ClO4/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-7,17-18H |
| InChIKey | CEYJHCLWEJDJFS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |