C14H9NO4 — CID 5413046
5,7-dihydroxy-3-pyridin-2-ylchromen-4-one (PubChem CID 5413046) has the molecular formula C14H9NO4 and a molecular weight of 255.23 g/mol. Its IUPAC name is 5,7-dihydroxy-3-pyridin-2-ylchromen-4-one.
| Compound Name | 5,7-dihydroxy-3-pyridin-2-ylchromen-4-one |
|---|---|
| PubChem CID | 5413046 |
| Molecular Formula | C14H9NO4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 5,7-dihydroxy-3-pyridin-2-ylchromen-4-one |
| SMILES | O=c1c(-c2ccccn2)coc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C14H9NO4/c16-8-5-11(17)13-12(6-8)19-7-9(14(13)18)10-3-1-2-4-15-10/h1-7,16-17H |
| InChIKey | MAVBOWDRNHRQLC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |