About (E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one
(E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one (PubChem CID 10657726) has the molecular formula C14H11NO3
and a molecular weight of 241.25 g/mol. Its IUPAC name is (E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one |
| PubChem CID | 10657726 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccncc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H11NO3/c16-11-2-3-12(14(18)9-11)13(17)4-1-10-5-7-15-8-6-10/h1-9,16,18H/b4-1+ |
| InChIKey | SWWOLTIJLQYLTE-DAFODLJHSA-N |
| XLogP | 2.39 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one?
The IUPAC name of (E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one (CID 10657726) is (E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one.
What is the SMILES notation for (E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one?
The canonical SMILES for (E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one is O=C(/C=C/c1ccncc1)c1ccc(O)cc1O.
What is the InChIKey of (E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one?
The InChIKey is SWWOLTIJLQYLTE-DAFODLJHSA-N. The full InChI is InChI=1S/C14H11NO3/c16-11-2-3-12(14(18)9-11)13(17)4-1-10-5-7-15-8-6-10/h1-9,16,18H/b4-1+.
What are the key properties of (E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one?
(E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one has a molecular weight of 241.25 g/mol, XLogP of 2.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2,4-dihydroxyphenyl)-3-pyridin-4-ylprop-2-en-1-one is sourced from PubChem (CID 10657726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).