C15H9ClO5 — CID 90876444
3-(3-chloro-4-hydroxyphenyl)-5,7-dihydroxychromen-4-one (PubChem CID 90876444) has the molecular formula C15H9ClO5 and a molecular weight of 304.69 g/mol. Its IUPAC name is 3-(3-chloro-4-hydroxyphenyl)-5,7-dihydroxychromen-4-one.
| Compound Name | 3-(3-chloro-4-hydroxyphenyl)-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 90876444 |
| Molecular Formula | C15H9ClO5 |
| Molecular Weight | 304.69 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 3-(3-chloro-4-hydroxyphenyl)-5,7-dihydroxychromen-4-one |
| SMILES | O=c1c(-c2ccc(O)c(Cl)c2)coc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H9ClO5/c16-10-3-7(1-2-11(10)18)9-6-21-13-5-8(17)4-12(19)14(13)15(9)20/h1-6,17-19H |
| InChIKey | DZOBNSBCZNWJGO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.69 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |