C16H12O5 — CID 143775868
3-(3,4-dihydroxyphenyl)-5-hydroxy-7-methylchromen-4-one (PubChem CID 143775868) has the molecular formula C16H12O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-5-hydroxy-7-methylchromen-4-one.
| Compound Name | 3-(3,4-dihydroxyphenyl)-5-hydroxy-7-methylchromen-4-one |
|---|---|
| PubChem CID | 143775868 |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-5-hydroxy-7-methylchromen-4-one |
| SMILES | Cc1cc(O)c2c(=O)c(-c3ccc(O)c(O)c3)coc2c1 |
| InChI | InChI=1S/C16H12O5/c1-8-4-13(19)15-14(5-8)21-7-10(16(15)20)9-2-3-11(17)12(18)6-9/h2-7,17-19H,1H3 |
| InChIKey | JIKXWNNWUFILKU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|