C17H13FO4 — CID 141110226
5-fluoro-3-[4-hydroxy-3-(hydroxymethyl)phenyl]-6-methylchromen-4-one (PubChem CID 141110226) has the molecular formula C17H13FO4 and a molecular weight of 300.29 g/mol. Its IUPAC name is 5-fluoro-3-[4-hydroxy-3-(hydroxymethyl)phenyl]-6-methylchromen-4-one.
| Compound Name | 5-fluoro-3-[4-hydroxy-3-(hydroxymethyl)phenyl]-6-methylchromen-4-one |
|---|---|
| PubChem CID | 141110226 |
| Molecular Formula | C17H13FO4 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 5-fluoro-3-[4-hydroxy-3-(hydroxymethyl)phenyl]-6-methylchromen-4-one |
| SMILES | Cc1ccc2occ(-c3ccc(O)c(CO)c3)c(=O)c2c1F |
| InChI | InChI=1S/C17H13FO4/c1-9-2-5-14-15(16(9)18)17(21)12(8-22-14)10-3-4-13(20)11(6-10)7-19/h2-6,8,19-20H,7H2,1H3 |
| InChIKey | AMDUBVVMGPBLBQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |