C20H18O6 — CID 11013649
5,7-dihydroxy-3-[4-hydroxy-3-(2-hydroxy-3-methylbut-3-enyl)phenyl]chromen-4-one (PubChem CID 11013649) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is 5,7-dihydroxy-3-[4-hydroxy-3-(2-hydroxy-3-methylbut-3-enyl)phenyl]chromen-4-one.
| Compound Name | 5,7-dihydroxy-3-[4-hydroxy-3-(2-hydroxy-3-methylbut-3-enyl)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 11013649 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 5,7-dihydroxy-3-[4-hydroxy-3-(2-hydroxy-3-methylbut-3-enyl)phenyl]chromen-4-one |
| SMILES | C=C(C)C(O)Cc1cc(-c2coc3cc(O)cc(O)c3c2=O)ccc1O |
| InChI | InChI=1S/C20H18O6/c1-10(2)16(23)6-12-5-11(3-4-15(12)22)14-9-26-18-8-13(21)7-17(24)19(18)20(14)25/h3-5,7-9,16,21-24H,1,6H2,2H3 |
| InChIKey | UGBJBPPUHGPDNB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|