About 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide)
5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide) (PubChem CID 139061674) has the molecular formula C27H22N4O7
and a molecular weight of 514.49 g/mol. Its IUPAC name is 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide).
Molecular Properties
| Compound Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide) |
| PubChem CID | 139061674 |
| Molecular Formula | C27H22N4O7 |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide) |
| SMILES | NC(=O)c1ccncc1.NC(=O)c1ccncc1.O=c1c(-c2ccc(O)cc2)coc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O5.2C6H6N2O/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19;2*7-6(9)5-1-3-8-4-2-5/h1-7,16-18H;2*1-4H,(H2,7,9) |
| InChIKey | DTOFRSWWBHWRIO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 202.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide)?
The IUPAC name of 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide) (CID 139061674) is 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide).
What is the SMILES notation for 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide)?
The canonical SMILES for 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide) is NC(=O)c1ccncc1.NC(=O)c1ccncc1.O=c1c(-c2ccc(O)cc2)coc2cc(O)cc(O)c12.
What is the InChIKey of 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide)?
The InChIKey is DTOFRSWWBHWRIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O5.2C6H6N2O/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19;2*7-6(9)5-1-3-8-4-2-5/h1-7,16-18H;2*1-4H,(H2,7,9).
What are the key properties of 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide)?
5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide) has a molecular weight of 514.49 g/mol, XLogP of 2.94, 3 rotatable bonds, 5 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;bis(pyridine-4-carboxamide) is sourced from PubChem (CID 139061674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).