C21H18N2O5 — CID 24971216
5-hydroxy-3-(4-hydroxyphenyl)-7-(3-imidazol-1-ylpropoxy)chromen-4-one (PubChem CID 24971216) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is 5-hydroxy-3-(4-hydroxyphenyl)-7-(3-imidazol-1-ylpropoxy)chromen-4-one.
| Compound Name | 5-hydroxy-3-(4-hydroxyphenyl)-7-(3-imidazol-1-ylpropoxy)chromen-4-one |
|---|---|
| PubChem CID | 24971216 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 5-hydroxy-3-(4-hydroxyphenyl)-7-(3-imidazol-1-ylpropoxy)chromen-4-one |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(OCCCn3ccnc3)cc(O)c12 |
| InChI | InChI=1S/C21H18N2O5/c24-15-4-2-14(3-5-15)17-12-28-19-11-16(10-18(25)20(19)21(17)26)27-9-1-7-23-8-6-22-13-23/h2-6,8,10-13,24-25H,1,7,9H2 |
| InChIKey | HABOPTAQEPXHEO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|