C23H24N2O5 — CID 10949584
5-hydroxy-7-(4-oxo-4-piperazin-1-ylbutoxy)-3-phenylchromen-4-one (PubChem CID 10949584) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 5-hydroxy-7-(4-oxo-4-piperazin-1-ylbutoxy)-3-phenylchromen-4-one.
| Compound Name | 5-hydroxy-7-(4-oxo-4-piperazin-1-ylbutoxy)-3-phenylchromen-4-one |
|---|---|
| PubChem CID | 10949584 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 5-hydroxy-7-(4-oxo-4-piperazin-1-ylbutoxy)-3-phenylchromen-4-one |
| SMILES | O=C(CCCOc1cc(O)c2c(=O)c(-c3ccccc3)coc2c1)N1CCNCC1 |
| InChI | InChI=1S/C23H24N2O5/c26-19-13-17(29-12-4-7-21(27)25-10-8-24-9-11-25)14-20-22(19)23(28)18(15-30-20)16-5-2-1-3-6-16/h1-3,5-6,13-15,24,26H,4,7-12H2 |
| InChIKey | AWJFNRBWGKUILK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|