C23H24N2O6 — CID 163355414
5-hydroxy-3-(4-methoxyphenyl)-7-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]chromen-4-one (PubChem CID 163355414) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is 5-hydroxy-3-(4-methoxyphenyl)-7-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]chromen-4-one.
| Compound Name | 5-hydroxy-3-(4-methoxyphenyl)-7-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]chromen-4-one |
|---|---|
| PubChem CID | 163355414 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 5-hydroxy-3-(4-methoxyphenyl)-7-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]chromen-4-one |
| SMILES | COc1ccc(-c2coc3cc(OCC(=O)N4CCN(C)CC4)cc(O)c3c2=O)cc1 |
| InChI | InChI=1S/C23H24N2O6/c1-24-7-9-25(10-8-24)21(27)14-30-17-11-19(26)22-20(12-17)31-13-18(23(22)28)15-3-5-16(29-2)6-4-15/h3-6,11-13,26H,7-10,14H2,1-2H3 |
| InChIKey | KYAVBVABNIASQL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |