C26H28O5 — CID 163053489
7-(3,7-dimethylocta-2,6-dienoxy)-5-hydroxy-3-(4-methoxyphenyl)chromen-4-one (PubChem CID 163053489) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is 7-(3,7-dimethylocta-2,6-dienoxy)-5-hydroxy-3-(4-methoxyphenyl)chromen-4-one.
| Compound Name | 7-(3,7-dimethylocta-2,6-dienoxy)-5-hydroxy-3-(4-methoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 163053489 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 7-(3,7-dimethylocta-2,6-dienoxy)-5-hydroxy-3-(4-methoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2coc3cc(OCC=C(C)CCC=C(C)C)cc(O)c3c2=O)cc1 |
| InChI | InChI=1S/C26H28O5/c1-17(2)6-5-7-18(3)12-13-30-21-14-23(27)25-24(15-21)31-16-22(26(25)28)19-8-10-20(29-4)11-9-19/h6,8-12,14-16,27H,5,7,13H2,1-4H3 |
| InChIKey | BCMWIEXPSAVRQD-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|