C19H16BrNO6 — CID 70687672
[5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] N-(2-bromoethyl)carbamate (PubChem CID 70687672) has the molecular formula C19H16BrNO6 and a molecular weight of 434.24 g/mol. Its IUPAC name is [5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] N-(2-bromoethyl)carbamate.
| Compound Name | [5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] N-(2-bromoethyl)carbamate |
|---|---|
| PubChem CID | 70687672 |
| Molecular Formula | C19H16BrNO6 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | [5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] N-(2-bromoethyl)carbamate |
| SMILES | COc1ccc(-c2coc3cc(OC(=O)NCCBr)cc(O)c3c2=O)cc1 |
| InChI | InChI=1S/C19H16BrNO6/c1-25-12-4-2-11(3-5-12)14-10-26-16-9-13(27-19(24)21-7-6-20)8-15(22)17(16)18(14)23/h2-5,8-10,22H,6-7H2,1H3,(H,21,24) |
| InChIKey | MFFJXFXUMUVPNE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|