C21H21BrO6 — CID 141260005
3-[4-(4-bromobutoxy)phenyl]-5-hydroxy-7-(methoxymethoxy)chromen-4-one (PubChem CID 141260005) has the molecular formula C21H21BrO6 and a molecular weight of 449.30 g/mol. Its IUPAC name is 3-[4-(4-bromobutoxy)phenyl]-5-hydroxy-7-(methoxymethoxy)chromen-4-one.
| Compound Name | 3-[4-(4-bromobutoxy)phenyl]-5-hydroxy-7-(methoxymethoxy)chromen-4-one |
|---|---|
| PubChem CID | 141260005 |
| Molecular Formula | C21H21BrO6 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 3-[4-(4-bromobutoxy)phenyl]-5-hydroxy-7-(methoxymethoxy)chromen-4-one |
| SMILES | COCOc1cc(O)c2c(=O)c(-c3ccc(OCCCCBr)cc3)coc2c1 |
| InChI | InChI=1S/C21H21BrO6/c1-25-13-28-16-10-18(23)20-19(11-16)27-12-17(21(20)24)14-4-6-15(7-5-14)26-9-3-2-8-22/h4-7,10-12,23H,2-3,8-9,13H2,1H3 |
| InChIKey | AYPXMHXULJIMCN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|