C17H13BrO8S — CID 141070425
5-[7-(2-bromoethoxy)-5-hydroxy-4-oxochromen-3-yl]-2-hydroxybenzenesulfonic acid (PubChem CID 141070425) has the molecular formula C17H13BrO8S and a molecular weight of 457.25 g/mol. Its IUPAC name is 5-[7-(2-bromoethoxy)-5-hydroxy-4-oxochromen-3-yl]-2-hydroxybenzenesulfonic acid.
| Compound Name | 5-[7-(2-bromoethoxy)-5-hydroxy-4-oxochromen-3-yl]-2-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 141070425 |
| Molecular Formula | C17H13BrO8S |
| Molecular Weight | 457.25 g/mol |
| Exact Mass | 455.95 |
| IUPAC Name | 5-[7-(2-bromoethoxy)-5-hydroxy-4-oxochromen-3-yl]-2-hydroxybenzenesulfonic acid |
| SMILES | O=c1c(-c2ccc(O)c(S(=O)(=O)O)c2)coc2cc(OCCBr)cc(O)c12 |
| InChI | InChI=1S/C17H13BrO8S/c18-3-4-25-10-6-13(20)16-14(7-10)26-8-11(17(16)21)9-1-2-12(19)15(5-9)27(22,23)24/h1-2,5-8,19-20H,3-4H2,(H,22,23,24) |
| InChIKey | VARCFTJIFBIETP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|