C45H54N4O5 — CID 162676067
7-[4-(4-benzylpiperazin-1-yl)butoxy]-3-[4-[4-(4-benzylpiperazin-1-yl)butoxy]phenyl]-5-hydroxychromen-4-one (PubChem CID 162676067) has the molecular formula C45H54N4O5 and a molecular weight of 730.95 g/mol. Its IUPAC name is 7-[4-(4-benzylpiperazin-1-yl)butoxy]-3-[4-[4-(4-benzylpiperazin-1-yl)butoxy]phenyl]-5-hydroxychromen-4-one.
| Compound Name | 7-[4-(4-benzylpiperazin-1-yl)butoxy]-3-[4-[4-(4-benzylpiperazin-1-yl)butoxy]phenyl]-5-hydroxychromen-4-one |
|---|---|
| PubChem CID | 162676067 |
| Molecular Formula | C45H54N4O5 |
| Molecular Weight | 730.95 g/mol |
| Exact Mass | 730.41 |
| IUPAC Name | 7-[4-(4-benzylpiperazin-1-yl)butoxy]-3-[4-[4-(4-benzylpiperazin-1-yl)butoxy]phenyl]-5-hydroxychromen-4-one |
| SMILES | O=c1c(-c2ccc(OCCCCN3CCN(Cc4ccccc4)CC3)cc2)coc2cc(OCCCCN3CCN(Cc4ccccc4)CC3)cc(O)c12 |
| InChI | InChI=1S/C45H54N4O5/c50-42-31-40(53-30-10-8-20-47-23-27-49(28-24-47)34-37-13-5-2-6-14-37)32-43-44(42)45(51)41(35-54-43)38-15-17-39(18-16-38)52-29-9-7-19-46-21-25-48(26-22-46)33-36-11-3-1-4-12-36/h1-6,11-18,31-32,35,50H,7-10,19-30,33-34H2 |
| InChIKey | UIHDOYWEDATPEW-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.95 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|