C29H27NO6 — CID 71664265
[5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] 4-benzylpiperidine-1-carboxylate (PubChem CID 71664265) has the molecular formula C29H27NO6 and a molecular weight of 485.54 g/mol. Its IUPAC name is [5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] 4-benzylpiperidine-1-carboxylate.
| Compound Name | [5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] 4-benzylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 71664265 |
| Molecular Formula | C29H27NO6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | [5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] 4-benzylpiperidine-1-carboxylate |
| SMILES | COc1ccc(-c2coc3cc(OC(=O)N4CCC(Cc5ccccc5)CC4)cc(O)c3c2=O)cc1 |
| InChI | InChI=1S/C29H27NO6/c1-34-22-9-7-21(8-10-22)24-18-35-26-17-23(16-25(31)27(26)28(24)32)36-29(33)30-13-11-20(12-14-30)15-19-5-3-2-4-6-19/h2-10,16-18,20,31H,11-15H2,1H3 |
| InChIKey | DIWDNPKUBLDSET-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |