C24H25NO7 — CID 171340353
2-[5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxy-N-(oxan-4-ylmethyl)acetamide (PubChem CID 171340353) has the molecular formula C24H25NO7 and a molecular weight of 439.46 g/mol. Its IUPAC name is 2-[5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxy-N-(oxan-4-ylmethyl)acetamide.
| Compound Name | 2-[5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxy-N-(oxan-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 171340353 |
| Molecular Formula | C24H25NO7 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-[5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxy-N-(oxan-4-ylmethyl)acetamide |
| SMILES | COc1ccc(-c2coc3cc(OCC(=O)NCC4CCOCC4)cc(O)c3c2=O)cc1 |
| InChI | InChI=1S/C24H25NO7/c1-29-17-4-2-16(3-5-17)19-13-32-21-11-18(10-20(26)23(21)24(19)28)31-14-22(27)25-12-15-6-8-30-9-7-15/h2-5,10-11,13,15,26H,6-9,12,14H2,1H3,(H,25,27) |
| InChIKey | DURHWHLRQCGWMD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |