C24H27N3O6 — CID 166633689
2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)phenoxy]-N-(oxan-4-ylmethyl)acetamide (PubChem CID 166633689) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)phenoxy]-N-(oxan-4-ylmethyl)acetamide.
| Compound Name | 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)phenoxy]-N-(oxan-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 166633689 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)phenoxy]-N-(oxan-4-ylmethyl)acetamide |
| SMILES | COc1cc(OC)c2c(=O)[nH]c(-c3ccc(OCC(=O)NCC4CCOCC4)cc3)nc2c1 |
| InChI | InChI=1S/C24H27N3O6/c1-30-18-11-19-22(20(12-18)31-2)24(29)27-23(26-19)16-3-5-17(6-4-16)33-14-21(28)25-13-15-7-9-32-10-8-15/h3-6,11-12,15H,7-10,13-14H2,1-2H3,(H,25,28)(H,26,27,29) |
| InChIKey | PYADGZOWAYAPAA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |