C27H26FN3O8 — CID 142764227
2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethoxyphenoxy]ethyl N-(4-fluorophenyl)carbamate (PubChem CID 142764227) has the molecular formula C27H26FN3O8 and a molecular weight of 539.52 g/mol. Its IUPAC name is 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethoxyphenoxy]ethyl N-(4-fluorophenyl)carbamate.
| Compound Name | 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethoxyphenoxy]ethyl N-(4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 142764227 |
| Molecular Formula | C27H26FN3O8 |
| Molecular Weight | 539.52 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethoxyphenoxy]ethyl N-(4-fluorophenyl)carbamate |
| SMILES | COc1cc(OC)c2c(=O)[nH]c(-c3cc(OC)c(OCCOC(=O)Nc4ccc(F)cc4)c(OC)c3)nc2c1 |
| InChI | InChI=1S/C27H26FN3O8/c1-34-18-13-19-23(20(14-18)35-2)26(32)31-25(30-19)15-11-21(36-3)24(22(12-15)37-4)38-9-10-39-27(33)29-17-7-5-16(28)6-8-17/h5-8,11-14H,9-10H2,1-4H3,(H,29,33)(H,30,31,32) |
| InChIKey | ROYNOGSTJTZFBG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|