C25H30N2O8 — CID 164785230
3-[2-[2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 164785230) has the molecular formula C25H30N2O8 and a molecular weight of 486.52 g/mol. Its IUPAC name is 3-[2-[2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 164785230 |
| Molecular Formula | C25H30N2O8 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 3-[2-[2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | COc1cc(OC)c2c(=O)[nH]c(-c3cc(C)c(OCCOCCOCCC(=O)O)c(C)c3)nc2c1 |
| InChI | InChI=1S/C25H30N2O8/c1-15-11-17(12-16(2)23(15)35-10-9-34-8-7-33-6-5-21(28)29)24-26-19-13-18(31-3)14-20(32-4)22(19)25(30)27-24/h11-14H,5-10H2,1-4H3,(H,28,29)(H,26,27,30) |
| InChIKey | LMFYCSWGLGACFL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|