C26H27N3O9S2 — CID 175716467
2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]ethyl (5-methyl-2-sulfamoylthiophen-3-yl) carbonate (PubChem CID 175716467) has the molecular formula C26H27N3O9S2 and a molecular weight of 589.65 g/mol. Its IUPAC name is 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]ethyl (5-methyl-2-sulfamoylthiophen-3-yl) carbonate.
| Compound Name | 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]ethyl (5-methyl-2-sulfamoylthiophen-3-yl) carbonate |
|---|---|
| PubChem CID | 175716467 |
| Molecular Formula | C26H27N3O9S2 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.12 |
| IUPAC Name | 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]ethyl (5-methyl-2-sulfamoylthiophen-3-yl) carbonate |
| SMILES | COc1cc(OC)c2c(=O)[nH]c(-c3cc(C)c(OCCOC(=O)Oc4cc(C)sc4S(N)(=O)=O)c(C)c3)nc2c1 |
| InChI | InChI=1S/C26H27N3O9S2/c1-13-8-16(23-28-18-11-17(34-4)12-19(35-5)21(18)24(30)29-23)9-14(2)22(13)36-6-7-37-26(31)38-20-10-15(3)39-25(20)40(27,32)33/h8-12H,6-7H2,1-5H3,(H2,27,32,33)(H,28,29,30) |
| InChIKey | IMJXUAKCZITHEZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|