C21H23N3O4 — CID 136611317
3-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenyl]propanamide (PubChem CID 136611317) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenyl]propanamide.
| Compound Name | 3-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenyl]propanamide |
|---|---|
| PubChem CID | 136611317 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenyl]propanamide |
| SMILES | COc1cc(OC)c2c(=O)[nH]c(-c3cc(C)c(CCC(N)=O)c(C)c3)nc2c1 |
| InChI | InChI=1S/C21H23N3O4/c1-11-7-13(8-12(2)15(11)5-6-18(22)25)20-23-16-9-14(27-3)10-17(28-4)19(16)21(26)24-20/h7-10H,5-6H2,1-4H3,(H2,22,25)(H,23,24,26) |
| InChIKey | AUGIXJLKPVTDQE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |