C17H16N2O3 — CID 166629023
5,7-dimethoxy-2-(3-methylphenyl)-3H-quinazolin-4-one (PubChem CID 166629023) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 5,7-dimethoxy-2-(3-methylphenyl)-3H-quinazolin-4-one.
| Compound Name | 5,7-dimethoxy-2-(3-methylphenyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 166629023 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 5,7-dimethoxy-2-(3-methylphenyl)-3H-quinazolin-4-one |
| SMILES | COc1cc(OC)c2c(=O)[nH]c(-c3cccc(C)c3)nc2c1 |
| InChI | InChI=1S/C17H16N2O3/c1-10-5-4-6-11(7-10)16-18-13-8-12(21-2)9-14(22-3)15(13)17(20)19-16/h4-9H,1-3H3,(H,18,19,20) |
| InChIKey | LZFNJRYLCGMJLS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |