C26H27N3O4 — CID 136642583
2-[4-(2-anilinoethoxy)-3,5-dimethylphenyl]-5,7-dimethoxy-3H-quinazolin-4-one (PubChem CID 136642583) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-[4-(2-anilinoethoxy)-3,5-dimethylphenyl]-5,7-dimethoxy-3H-quinazolin-4-one.
| Compound Name | 2-[4-(2-anilinoethoxy)-3,5-dimethylphenyl]-5,7-dimethoxy-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136642583 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-[4-(2-anilinoethoxy)-3,5-dimethylphenyl]-5,7-dimethoxy-3H-quinazolin-4-one |
| SMILES | COc1cc(OC)c2c(=O)[nH]c(-c3cc(C)c(OCCNc4ccccc4)c(C)c3)nc2c1 |
| InChI | InChI=1S/C26H27N3O4/c1-16-12-18(13-17(2)24(16)33-11-10-27-19-8-6-5-7-9-19)25-28-21-14-20(31-3)15-22(32-4)23(21)26(30)29-25/h5-9,12-15,27H,10-11H2,1-4H3,(H,28,29,30) |
| InChIKey | VXLNYOZUPJNDII-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|