C34H42N4O8 — CID 176514908
2-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]-5,7-dimethoxy-3H-quinazolin-4-one;N'-hydroxy-N-phenyloctanediamide (PubChem CID 176514908) has the molecular formula C34H42N4O8 and a molecular weight of 634.73 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]-5,7-dimethoxy-3H-quinazolin-4-one;N'-hydroxy-N-phenyloctanediamide.
| Compound Name | 2-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]-5,7-dimethoxy-3H-quinazolin-4-one;N'-hydroxy-N-phenyloctanediamide |
|---|---|
| PubChem CID | 176514908 |
| Molecular Formula | C34H42N4O8 |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.30 |
| IUPAC Name | 2-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]-5,7-dimethoxy-3H-quinazolin-4-one;N'-hydroxy-N-phenyloctanediamide |
| SMILES | COc1cc(OC)c2c(=O)[nH]c(-c3cc(C)c(OCCO)c(C)c3)nc2c1.O=C(CCCCCCC(=O)Nc1ccccc1)NO |
| InChI | InChI=1S/C20H22N2O5.C14H20N2O3/c1-11-7-13(8-12(2)18(11)27-6-5-23)19-21-15-9-14(25-3)10-16(26-4)17(15)20(24)22-19;17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h7-10,23H,5-6H2,1-4H3,(H,21,22,24);3-5,8-9,19H,1-2,6-7,10-11H2,(H,15,17)(H,16,18) |
| InChIKey | DFTRKWLFIDOLPM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 172.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|