C24H24ClN3O3 — CID 71737015
2-[4-[4-(4-chlorophenyl)pyrimidin-2-yl]phenoxy]-N-(oxan-4-ylmethyl)acetamide (PubChem CID 71737015) has the molecular formula C24H24ClN3O3 and a molecular weight of 437.93 g/mol. Its IUPAC name is 2-[4-[4-(4-chlorophenyl)pyrimidin-2-yl]phenoxy]-N-(oxan-4-ylmethyl)acetamide.
| Compound Name | 2-[4-[4-(4-chlorophenyl)pyrimidin-2-yl]phenoxy]-N-(oxan-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 71737015 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-[4-[4-(4-chlorophenyl)pyrimidin-2-yl]phenoxy]-N-(oxan-4-ylmethyl)acetamide |
| SMILES | O=C(COc1ccc(-c2nccc(-c3ccc(Cl)cc3)n2)cc1)NCC1CCOCC1 |
| InChI | InChI=1S/C24H24ClN3O3/c25-20-5-1-18(2-6-20)22-9-12-26-24(28-22)19-3-7-21(8-4-19)31-16-23(29)27-15-17-10-13-30-14-11-17/h1-9,12,17H,10-11,13-16H2,(H,27,29) |
| InChIKey | RKEZOEHVHFCFLR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |