C22H32N2O5 — CID 88921448
2-[4-[(Z)-C-methyl-N-(oxan-4-ylmethoxy)carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide (PubChem CID 88921448) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-[4-[(Z)-C-methyl-N-(oxan-4-ylmethoxy)carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide.
| Compound Name | 2-[4-[(Z)-C-methyl-N-(oxan-4-ylmethoxy)carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 88921448 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 2-[4-[(Z)-C-methyl-N-(oxan-4-ylmethoxy)carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide |
| SMILES | C/C(=N/OCC1CCOCC1)c1ccc(OCC(=O)NCC2CCOCC2)cc1 |
| InChI | InChI=1S/C22H32N2O5/c1-17(24-29-15-19-8-12-27-13-9-19)20-2-4-21(5-3-20)28-16-22(25)23-14-18-6-10-26-11-7-18/h2-5,18-19H,6-16H2,1H3,(H,23,25)/b24-17- |
| InChIKey | QFUWXMNVVSRONK-ULJHMMPZSA-N |
| XLogP | 2.78 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|