C26H31F3N2O4 — CID 57415357
2-methyl-2-[4-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)propanamide (PubChem CID 57415357) has the molecular formula C26H31F3N2O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is 2-methyl-2-[4-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)propanamide.
| Compound Name | 2-methyl-2-[4-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 57415357 |
| Molecular Formula | C26H31F3N2O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 2-methyl-2-[4-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)propanamide |
| SMILES | C/C(=N\OCc1ccc(C(F)(F)F)cc1)c1ccc(OC(C)(C)C(=O)NCC2CCOCC2)cc1 |
| InChI | InChI=1S/C26H31F3N2O4/c1-18(31-34-17-20-4-8-22(9-5-20)26(27,28)29)21-6-10-23(11-7-21)35-25(2,3)24(32)30-16-19-12-14-33-15-13-19/h4-11,19H,12-17H2,1-3H3,(H,30,32)/b31-18+ |
| InChIKey | JJRXLAJXBBWOIP-FDAWAROLSA-N |
| XLogP | 5.35 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|