C28H34F3N3O5 — CID 173469232
2-[4-[2-morpholin-4-yl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide (PubChem CID 173469232) has the molecular formula C28H34F3N3O5 and a molecular weight of 549.59 g/mol. Its IUPAC name is 2-[4-[2-morpholin-4-yl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide.
| Compound Name | 2-[4-[2-morpholin-4-yl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 173469232 |
| Molecular Formula | C28H34F3N3O5 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | 2-[4-[2-morpholin-4-yl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide |
| SMILES | O=C(COc1ccc(CC(=NOCc2ccc(C(F)(F)F)cc2)N2CCOCC2)cc1)NCC1CCOCC1 |
| InChI | InChI=1S/C28H34F3N3O5/c29-28(30,31)24-5-1-23(2-6-24)19-39-33-26(34-11-15-37-16-12-34)17-21-3-7-25(8-4-21)38-20-27(35)32-18-22-9-13-36-14-10-22/h1-8,22H,9-20H2,(H,32,35) |
| InChIKey | ZEBHAOXZRXXIPO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|