C24H25F3N2O4 — CID 90021059
N-(3,4-dihydro-2H-pyran-4-ylmethyl)-2-[4-[2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]acetamide (PubChem CID 90021059) has the molecular formula C24H25F3N2O4 and a molecular weight of 462.47 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-pyran-4-ylmethyl)-2-[4-[2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]acetamide.
| Compound Name | N-(3,4-dihydro-2H-pyran-4-ylmethyl)-2-[4-[2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 90021059 |
| Molecular Formula | C24H25F3N2O4 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N-(3,4-dihydro-2H-pyran-4-ylmethyl)-2-[4-[2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccc(CC=NOCc2ccc(C(F)(F)F)cc2)cc1)NCC1C=COCC1 |
| InChI | InChI=1S/C24H25F3N2O4/c25-24(26,27)21-5-1-20(2-6-21)16-33-29-12-9-18-3-7-22(8-4-18)32-17-23(30)28-15-19-10-13-31-14-11-19/h1-8,10,12-13,19H,9,11,14-17H2,(H,28,30) |
| InChIKey | PPNIKHPCTWNDHN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|