C26H29F3N2O3 — CID 90021177
1-(6-azaspiro[2.5]octan-6-yl)-2-[4-[3-[[4-(trifluoromethyl)phenyl]methoxyimino]propyl]phenoxy]ethanone (PubChem CID 90021177) has the molecular formula C26H29F3N2O3 and a molecular weight of 474.52 g/mol. Its IUPAC name is 1-(6-azaspiro[2.5]octan-6-yl)-2-[4-[3-[[4-(trifluoromethyl)phenyl]methoxyimino]propyl]phenoxy]ethanone.
| Compound Name | 1-(6-azaspiro[2.5]octan-6-yl)-2-[4-[3-[[4-(trifluoromethyl)phenyl]methoxyimino]propyl]phenoxy]ethanone |
|---|---|
| PubChem CID | 90021177 |
| Molecular Formula | C26H29F3N2O3 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 1-(6-azaspiro[2.5]octan-6-yl)-2-[4-[3-[[4-(trifluoromethyl)phenyl]methoxyimino]propyl]phenoxy]ethanone |
| SMILES | O=C(COc1ccc(CCC=NOCc2ccc(C(F)(F)F)cc2)cc1)N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C26H29F3N2O3/c27-26(28,29)22-7-3-21(4-8-22)18-34-30-15-1-2-20-5-9-23(10-6-20)33-19-24(32)31-16-13-25(11-12-25)14-17-31/h3-10,15H,1-2,11-14,16-19H2 |
| InChIKey | LCEHLAVCXZCWSY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|