C23H25F3N2O4 — CID 90021079
2-[4-[(E)-C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 90021079) has the molecular formula C23H25F3N2O4 and a molecular weight of 450.46 g/mol. Its IUPAC name is 2-[4-[(E)-C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-[(E)-C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 90021079 |
| Molecular Formula | C23H25F3N2O4 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-[4-[(E)-C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | CC/C(=N\OCc1ccc(C(F)(F)F)cc1)c1ccc(OCC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H25F3N2O4/c1-2-21(27-32-15-17-3-7-19(8-4-17)23(24,25)26)18-5-9-20(10-6-18)31-16-22(29)28-11-13-30-14-12-28/h3-10H,2,11-16H2,1H3/b27-21+ |
| InChIKey | DHTAFMGVPDXDTL-SZXQPVLSSA-N |
| XLogP | 4.27 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|