C25H29FN2O3 — CID 90021317
1-(6-azaspiro[2.5]octan-6-yl)-2-[4-[(E)-C-ethyl-N-[(4-fluorophenyl)methoxy]carbonimidoyl]phenoxy]ethanone (PubChem CID 90021317) has the molecular formula C25H29FN2O3 and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-(6-azaspiro[2.5]octan-6-yl)-2-[4-[(E)-C-ethyl-N-[(4-fluorophenyl)methoxy]carbonimidoyl]phenoxy]ethanone.
| Compound Name | 1-(6-azaspiro[2.5]octan-6-yl)-2-[4-[(E)-C-ethyl-N-[(4-fluorophenyl)methoxy]carbonimidoyl]phenoxy]ethanone |
|---|---|
| PubChem CID | 90021317 |
| Molecular Formula | C25H29FN2O3 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-(6-azaspiro[2.5]octan-6-yl)-2-[4-[(E)-C-ethyl-N-[(4-fluorophenyl)methoxy]carbonimidoyl]phenoxy]ethanone |
| SMILES | CC/C(=N\OCc1ccc(F)cc1)c1ccc(OCC(=O)N2CCC3(CC2)CC3)cc1 |
| InChI | InChI=1S/C25H29FN2O3/c1-2-23(27-31-17-19-3-7-21(26)8-4-19)20-5-9-22(10-6-20)30-18-24(29)28-15-13-25(11-12-25)14-16-28/h3-10H,2,11-18H2,1H3/b27-23+ |
| InChIKey | PYICWTFHMYITEP-SLEBQGDGSA-N |
| XLogP | 4.94 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|