C30H38N4O4 — CID 140667212
2-[4-[N-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]methoxy]-C-ethylcarbonimidoyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 140667212) has the molecular formula C30H38N4O4 and a molecular weight of 518.66 g/mol. Its IUPAC name is 2-[4-[N-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]methoxy]-C-ethylcarbonimidoyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-[N-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]methoxy]-C-ethylcarbonimidoyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 140667212 |
| Molecular Formula | C30H38N4O4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 2-[4-[N-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]methoxy]-C-ethylcarbonimidoyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | CCC(=NOCc1cc(C(C)(C)C)nn1-c1ccc(C)cc1)c1ccc(OCC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C30H38N4O4/c1-6-27(23-9-13-26(14-10-23)37-21-29(35)33-15-17-36-18-16-33)32-38-20-25-19-28(30(3,4)5)31-34(25)24-11-7-22(2)8-12-24/h7-14,19H,6,15-18,20-21H2,1-5H3 |
| InChIKey | RGVUYEQWPUOARK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 78.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|