C28H27F3N2O5 — CID 90020944
2-[4-[C-benzyl-N-[[4-(trifluoromethoxy)phenyl]methoxy]carbonimidoyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 90020944) has the molecular formula C28H27F3N2O5 and a molecular weight of 528.53 g/mol. Its IUPAC name is 2-[4-[C-benzyl-N-[[4-(trifluoromethoxy)phenyl]methoxy]carbonimidoyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-[C-benzyl-N-[[4-(trifluoromethoxy)phenyl]methoxy]carbonimidoyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 90020944 |
| Molecular Formula | C28H27F3N2O5 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 2-[4-[C-benzyl-N-[[4-(trifluoromethoxy)phenyl]methoxy]carbonimidoyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | O=C(COc1ccc(C(Cc2ccccc2)=NOCc2ccc(OC(F)(F)F)cc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C28H27F3N2O5/c29-28(30,31)38-25-10-6-22(7-11-25)19-37-32-26(18-21-4-2-1-3-5-21)23-8-12-24(13-9-23)36-20-27(34)33-14-16-35-17-15-33/h1-13H,14-20H2 |
| InChIKey | AEAWIFQBZBXVKL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|