C29H29F3N2O4 — CID 90021226
2-[4-[C-benzyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]-1-morpholin-4-ylethanone (PubChem CID 90021226) has the molecular formula C29H29F3N2O4 and a molecular weight of 526.56 g/mol. Its IUPAC name is 2-[4-[C-benzyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-[C-benzyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 90021226 |
| Molecular Formula | C29H29F3N2O4 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 2-[4-[C-benzyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]-1-morpholin-4-ylethanone |
| SMILES | Cc1cc(C(Cc2ccccc2)=NOCc2ccc(C(F)(F)F)cc2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C29H29F3N2O4/c1-21-17-24(9-12-27(21)37-20-28(35)34-13-15-36-16-14-34)26(18-22-5-3-2-4-6-22)33-38-19-23-7-10-25(11-8-23)29(30,31)32/h2-12,17H,13-16,18-20H2,1H3 |
| InChIKey | RBMCYMHHOFUETK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|