C25H24F3NO4S — CID 87718253
2-[2-methyl-4-[C-(thiophen-3-ylmethyl)-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]butanoic acid (PubChem CID 87718253) has the molecular formula C25H24F3NO4S and a molecular weight of 491.53 g/mol. Its IUPAC name is 2-[2-methyl-4-[C-(thiophen-3-ylmethyl)-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]butanoic acid.
| Compound Name | 2-[2-methyl-4-[C-(thiophen-3-ylmethyl)-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 87718253 |
| Molecular Formula | C25H24F3NO4S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 2-[2-methyl-4-[C-(thiophen-3-ylmethyl)-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(C(Cc2ccsc2)=NOCc2ccc(C(F)(F)F)cc2)cc1C)C(=O)O |
| InChI | InChI=1S/C25H24F3NO4S/c1-3-22(24(30)31)33-23-9-6-19(12-16(23)2)21(13-18-10-11-34-15-18)29-32-14-17-4-7-20(8-5-17)25(26,27)28/h4-12,15,22H,3,13-14H2,1-2H3,(H,30,31) |
| InChIKey | PKZGJYBYADNVTJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|