C31H29F3N2O4S — CID 91255452
2-[2-methyl-4-[1-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxyamino]-2-phenylethenyl]phenoxy]butanoic acid (PubChem CID 91255452) has the molecular formula C31H29F3N2O4S and a molecular weight of 582.64 g/mol. Its IUPAC name is 2-[2-methyl-4-[1-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxyamino]-2-phenylethenyl]phenoxy]butanoic acid.
| Compound Name | 2-[2-methyl-4-[1-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxyamino]-2-phenylethenyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 91255452 |
| Molecular Formula | C31H29F3N2O4S |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | 2-[2-methyl-4-[1-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxyamino]-2-phenylethenyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(C(=Cc2ccccc2)NOCc2sc(-c3ccc(C(F)(F)F)cc3)nc2C)cc1C)C(=O)O |
| InChI | InChI=1S/C31H29F3N2O4S/c1-4-26(30(37)38)40-27-15-12-23(16-19(27)2)25(17-21-8-6-5-7-9-21)36-39-18-28-20(3)35-29(41-28)22-10-13-24(14-11-22)31(32,33)34/h5-17,26,36H,4,18H2,1-3H3,(H,37,38) |
| InChIKey | ULSRZTLJQIZFCL-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|