C27H26F3NO4 — CID 173144383
2-[2-methyl-4-[2-phenyl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]butanoic acid (PubChem CID 173144383) has the molecular formula C27H26F3NO4 and a molecular weight of 485.50 g/mol. Its IUPAC name is 2-[2-methyl-4-[2-phenyl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]butanoic acid.
| Compound Name | 2-[2-methyl-4-[2-phenyl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 173144383 |
| Molecular Formula | C27H26F3NO4 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 2-[2-methyl-4-[2-phenyl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(CC(=NOCc2ccc(C(F)(F)F)cc2)c2ccccc2)cc1C)C(=O)O |
| InChI | InChI=1S/C27H26F3NO4/c1-3-24(26(32)33)35-25-14-11-20(15-18(25)2)16-23(21-7-5-4-6-8-21)31-34-17-19-9-12-22(13-10-19)27(28,29)30/h4-15,24H,3,16-17H2,1-2H3,(H,32,33) |
| InChIKey | ZSKGNEYUGXGYRY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|