C20H18Cl2F3NO4 — CID 74423772
2-[2,3-dichloro-4-[3-hydroxyimino-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid (PubChem CID 74423772) has the molecular formula C20H18Cl2F3NO4 and a molecular weight of 464.27 g/mol. Its IUPAC name is 2-[2,3-dichloro-4-[3-hydroxyimino-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid.
| Compound Name | 2-[2,3-dichloro-4-[3-hydroxyimino-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 74423772 |
| Molecular Formula | C20H18Cl2F3NO4 |
| Molecular Weight | 464.27 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 2-[2,3-dichloro-4-[3-hydroxyimino-3-[4-(trifluoromethyl)phenyl]propyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(CCC(=NO)c2ccc(C(F)(F)F)cc2)c(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C20H18Cl2F3NO4/c1-2-15(19(27)28)30-16-10-6-12(17(21)18(16)22)5-9-14(26-29)11-3-7-13(8-4-11)20(23,24)25/h3-4,6-8,10,15,29H,2,5,9H2,1H3,(H,27,28) |
| InChIKey | GYFXCDWTEUVVCE-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.27 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|