C25H23Cl2F3N2O4S — CID 74424434
2-[2,3-dichloro-4-[3-methoxyimino-3-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propyl]phenoxy]-2-methylpropanoic acid (PubChem CID 74424434) has the molecular formula C25H23Cl2F3N2O4S and a molecular weight of 575.44 g/mol. Its IUPAC name is 2-[2,3-dichloro-4-[3-methoxyimino-3-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[2,3-dichloro-4-[3-methoxyimino-3-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 74424434 |
| Molecular Formula | C25H23Cl2F3N2O4S |
| Molecular Weight | 575.44 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | 2-[2,3-dichloro-4-[3-methoxyimino-3-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CON=C(CCc1ccc(OC(C)(C)C(=O)O)c(Cl)c1Cl)c1sc(-c2ccc(C(F)(F)F)cc2)nc1C |
| InChI | InChI=1S/C25H23Cl2F3N2O4S/c1-13-21(37-22(31-13)15-5-9-16(10-6-15)25(28,29)30)17(32-35-4)11-7-14-8-12-18(20(27)19(14)26)36-24(2,3)23(33)34/h5-6,8-10,12H,7,11H2,1-4H3,(H,33,34) |
| InChIKey | XYSHZZIDSCOGBM-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.44 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|