C28H27Cl2F3O4S — CID 152584314
butyl 2-[2,3-dichloro-4-[3-oxo-3-[4-[4-(trifluoromethyl)phenyl]thiophen-2-yl]propyl]phenoxy]-2-methylpropanoate (PubChem CID 152584314) has the molecular formula C28H27Cl2F3O4S and a molecular weight of 587.49 g/mol. Its IUPAC name is butyl 2-[2,3-dichloro-4-[3-oxo-3-[4-[4-(trifluoromethyl)phenyl]thiophen-2-yl]propyl]phenoxy]-2-methylpropanoate.
| Compound Name | butyl 2-[2,3-dichloro-4-[3-oxo-3-[4-[4-(trifluoromethyl)phenyl]thiophen-2-yl]propyl]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 152584314 |
| Molecular Formula | C28H27Cl2F3O4S |
| Molecular Weight | 587.49 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | butyl 2-[2,3-dichloro-4-[3-oxo-3-[4-[4-(trifluoromethyl)phenyl]thiophen-2-yl]propyl]phenoxy]-2-methylpropanoate |
| SMILES | CCCCOC(=O)C(C)(C)Oc1ccc(CCC(=O)c2cc(-c3ccc(C(F)(F)F)cc3)cs2)c(Cl)c1Cl |
| InChI | InChI=1S/C28H27Cl2F3O4S/c1-4-5-14-36-26(35)27(2,3)37-22-13-9-18(24(29)25(22)30)8-12-21(34)23-15-19(16-38-23)17-6-10-20(11-7-17)28(31,32)33/h6-7,9-11,13,15-16H,4-5,8,12,14H2,1-3H3 |
| InChIKey | YUDDQOWNXPAZQC-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.49 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|