C30H34F3NO4S — CID 67417787
2-[5-[3-[4-hexyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanoyl]-2-methylphenoxy]-2-methylpropanoic acid (PubChem CID 67417787) has the molecular formula C30H34F3NO4S and a molecular weight of 561.67 g/mol. Its IUPAC name is 2-[5-[3-[4-hexyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanoyl]-2-methylphenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[5-[3-[4-hexyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanoyl]-2-methylphenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 67417787 |
| Molecular Formula | C30H34F3NO4S |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | 2-[5-[3-[4-hexyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanoyl]-2-methylphenoxy]-2-methylpropanoic acid |
| SMILES | CCCCCCc1nc(-c2ccc(C(F)(F)F)cc2)sc1CCC(=O)c1ccc(C)c(OC(C)(C)C(=O)O)c1 |
| InChI | InChI=1S/C30H34F3NO4S/c1-5-6-7-8-9-23-26(39-27(34-23)20-12-14-22(15-13-20)30(31,32)33)17-16-24(35)21-11-10-19(2)25(18-21)38-29(3,4)28(36)37/h10-15,18H,5-9,16-17H2,1-4H3,(H,36,37) |
| InChIKey | IQNVKSACMYEWTH-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|