C30H34F3NO4S — CID 67419538
ethyl 2-[4-[3-[4-hexyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanoyl]-2-methylphenoxy]acetate (PubChem CID 67419538) has the molecular formula C30H34F3NO4S and a molecular weight of 561.67 g/mol. Its IUPAC name is ethyl 2-[4-[3-[4-hexyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanoyl]-2-methylphenoxy]acetate.
| Compound Name | ethyl 2-[4-[3-[4-hexyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanoyl]-2-methylphenoxy]acetate |
|---|---|
| PubChem CID | 67419538 |
| Molecular Formula | C30H34F3NO4S |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | ethyl 2-[4-[3-[4-hexyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanoyl]-2-methylphenoxy]acetate |
| SMILES | CCCCCCc1nc(-c2ccccc2C(F)(F)F)sc1CCC(=O)c1ccc(OCC(=O)OCC)c(C)c1 |
| InChI | InChI=1S/C30H34F3NO4S/c1-4-6-7-8-13-24-27(39-29(34-24)22-11-9-10-12-23(22)30(31,32)33)17-15-25(35)21-14-16-26(20(3)18-21)38-19-28(36)37-5-2/h9-12,14,16,18H,4-8,13,15,17,19H2,1-3H3 |
| InChIKey | VBKADNUGIXJVQJ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|