C25H24F3NO4S — CID 87392228
[2-methyl-4-[3-[4-propan-2-yl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanoyl]phenyl] ethaneperoxoate (PubChem CID 87392228) has the molecular formula C25H24F3NO4S and a molecular weight of 491.53 g/mol. Its IUPAC name is [2-methyl-4-[3-[4-propan-2-yl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanoyl]phenyl] ethaneperoxoate.
| Compound Name | [2-methyl-4-[3-[4-propan-2-yl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanoyl]phenyl] ethaneperoxoate |
|---|---|
| PubChem CID | 87392228 |
| Molecular Formula | C25H24F3NO4S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | [2-methyl-4-[3-[4-propan-2-yl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanoyl]phenyl] ethaneperoxoate |
| SMILES | CC(=O)OOc1ccc(C(=O)CCc2sc(-c3ccccc3C(F)(F)F)nc2C(C)C)cc1C |
| InChI | InChI=1S/C25H24F3NO4S/c1-14(2)23-22(34-24(29-23)18-7-5-6-8-19(18)25(26,27)28)12-10-20(31)17-9-11-21(15(3)13-17)33-32-16(4)30/h5-9,11,13-14H,10,12H2,1-4H3 |
| InChIKey | GJSUYNZRDHOCJL-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|