C26H31NO4S — CID 165116408
1-[4-(3-hydroxypropoxy)-3-methylphenyl]-3-[2-(4-methoxyphenyl)-4-propan-2-yl-1,3-thiazol-5-yl]propan-1-one (PubChem CID 165116408) has the molecular formula C26H31NO4S and a molecular weight of 453.60 g/mol. Its IUPAC name is 1-[4-(3-hydroxypropoxy)-3-methylphenyl]-3-[2-(4-methoxyphenyl)-4-propan-2-yl-1,3-thiazol-5-yl]propan-1-one.
| Compound Name | 1-[4-(3-hydroxypropoxy)-3-methylphenyl]-3-[2-(4-methoxyphenyl)-4-propan-2-yl-1,3-thiazol-5-yl]propan-1-one |
|---|---|
| PubChem CID | 165116408 |
| Molecular Formula | C26H31NO4S |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 1-[4-(3-hydroxypropoxy)-3-methylphenyl]-3-[2-(4-methoxyphenyl)-4-propan-2-yl-1,3-thiazol-5-yl]propan-1-one |
| SMILES | COc1ccc(-c2nc(C(C)C)c(CCC(=O)c3ccc(OCCCO)c(C)c3)s2)cc1 |
| InChI | InChI=1S/C26H31NO4S/c1-17(2)25-24(32-26(27-25)19-6-9-21(30-4)10-7-19)13-11-22(29)20-8-12-23(18(3)16-20)31-15-5-14-28/h6-10,12,16-17,28H,5,11,13-15H2,1-4H3 |
| InChIKey | MLHVZAILUDHYBH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|