C31H29F3N2O4S — CID 24948819
ethyl 2-[4-[(E)-C-benzyl-N-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]carbonimidoyl]-2-methylphenoxy]acetate (PubChem CID 24948819) has the molecular formula C31H29F3N2O4S and a molecular weight of 582.64 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-C-benzyl-N-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]carbonimidoyl]-2-methylphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-C-benzyl-N-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]carbonimidoyl]-2-methylphenoxy]acetate |
|---|---|
| PubChem CID | 24948819 |
| Molecular Formula | C31H29F3N2O4S |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | ethyl 2-[4-[(E)-C-benzyl-N-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]carbonimidoyl]-2-methylphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C(Cc2ccccc2)=N/OCc2sc(-c3ccc(C(F)(F)F)cc3)nc2C)cc1C |
| InChI | InChI=1S/C31H29F3N2O4S/c1-4-38-29(37)19-39-27-15-12-24(16-20(27)2)26(17-22-8-6-5-7-9-22)36-40-18-28-21(3)35-30(41-28)23-10-13-25(14-11-23)31(32,33)34/h5-16H,4,17-19H2,1-3H3/b36-26+ |
| InChIKey | CHARFGPLNPSGPO-LZBRRTOVSA-N |
| XLogP | 7.55 |
| TPSA | 70.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|