C22H20AsF3NO3S — CID 87878385
CID 87878385 (PubChem CID 87878385) has the molecular formula C22H20AsF3NO3S and a molecular weight of 510.39 g/mol.
| Compound Name | CID 87878385 |
|---|---|
| PubChem CID | 87878385 |
| Molecular Formula | C22H20AsF3NO3S |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 510.03 |
| IUPAC Name | — |
| SMILES | COC(=O)COc1ccc([As]Cc2sc(-c3ccc(C(F)(F)F)cc3)nc2C)cc1C |
| InChI | InChI=1S/C22H20AsF3NO3S/c1-13-10-17(8-9-18(13)30-12-20(28)29-3)23-11-19-14(2)27-21(31-19)15-4-6-16(7-5-15)22(24,25)26/h4-10H,11-12H2,1-3H3 |
| InChIKey | JGDODQOKAPHISZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|